Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid dipotassium magnesium salt dihydrate, 97%
CAS: 15708-48-2 Molecular Formula: C10H12K2MgN2O8 Molecular Weight (g/mol): 390.71 InChI Key: MUEOBEUHFKBRJH-UHFFFAOYSA-J IUPAC Name: magnesium(2+) dipotassium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate SMILES: [Mg++].[K+].[K+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| CAS | 15708-48-2 |
|---|---|
| Molecular Weight (g/mol) | 390.71 |
| SMILES | [Mg++].[K+].[K+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | magnesium(2+) dipotassium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate |
| InChI Key | MUEOBEUHFKBRJH-UHFFFAOYSA-J |
| Molecular Formula | C10H12K2MgN2O8 |
Lead(II) bromide, 98+%, extra pure
CAS: 10031-22-8 Molecular Formula: Br2Pb Molecular Weight (g/mol): 367.00 MDL Number: MFCD00011156 InChI Key: ZASWJUOMEGBQCQ-UHFFFAOYSA-L Synonym: lead ii bromide,lead bromide,lead dibromide,lead bromide pbbr2,pbbr2,lead 2+ bromide,dibromoplumbane,ccris 4220,leadbromide,acmc-1bq2x PubChem CID: 24831 SMILES: [Br-].[Br-].[Pb++]
| PubChem CID | 24831 |
|---|---|
| CAS | 10031-22-8 |
| Molecular Weight (g/mol) | 367.00 |
| MDL Number | MFCD00011156 |
| SMILES | [Br-].[Br-].[Pb++] |
| Synonym | lead ii bromide,lead bromide,lead dibromide,lead bromide pbbr2,pbbr2,lead 2+ bromide,dibromoplumbane,ccris 4220,leadbromide,acmc-1bq2x |
| InChI Key | ZASWJUOMEGBQCQ-UHFFFAOYSA-L |
| Molecular Formula | Br2Pb |
Triethylsilane, 99%
CAS: 617-86-7 Molecular Formula: C6H16Si Molecular Weight (g/mol): 116.28 InChI Key: QXTIBZLKQPJVII-UHFFFAOYSA-N Synonym: triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes PubChem CID: 6327258 IUPAC Name: triethylsilicon SMILES: CC[Si](CC)CC
| PubChem CID | 6327258 |
|---|---|
| CAS | 617-86-7 |
| Molecular Weight (g/mol) | 116.28 |
| SMILES | CC[Si](CC)CC |
| Synonym | triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes |
| IUPAC Name | triethylsilicon |
| InChI Key | QXTIBZLKQPJVII-UHFFFAOYSA-N |
| Molecular Formula | C6H16Si |
Copper gauze, 20 mesh woven from 0.41mm (0.016in) dia wire
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Sodium Chloride USP/FCC Granular, Macron Fine Chemicals™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Barium nitrate, ACS, 99+%
CAS: 10022-31-8 Molecular Formula: BaN2O6 Molecular Weight (g/mol): 261.34 MDL Number: MFCD00003442 InChI Key: IWOUKMZUPDVPGQ-UHFFFAOYSA-N Synonym: barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 PubChem CID: 24798 SMILES: [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24798 |
|---|---|
| CAS | 10022-31-8 |
| Molecular Weight (g/mol) | 261.34 |
| MDL Number | MFCD00003442 |
| SMILES | [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 |
| InChI Key | IWOUKMZUPDVPGQ-UHFFFAOYSA-N |
| Molecular Formula | BaN2O6 |
Sodium metaborate tetrahydrate, 98%
CAS: 10555-76-7 Molecular Formula: BH8NaO6 Molecular Weight (g/mol): 137.86 MDL Number: MFCD00149205 InChI Key: JAKYJVJWXKRTSJ-UHFFFAOYSA-N Synonym: sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate PubChem CID: 23694267 IUPAC Name: sodium;oxido(oxo)borane;tetrahydrate SMILES: O.O.O.O.[Na+].[O-]B=O
| PubChem CID | 23694267 |
|---|---|
| CAS | 10555-76-7 |
| Molecular Weight (g/mol) | 137.86 |
| MDL Number | MFCD00149205 |
| SMILES | O.O.O.O.[Na+].[O-]B=O |
| Synonym | sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate |
| IUPAC Name | sodium;oxido(oxo)borane;tetrahydrate |
| InChI Key | JAKYJVJWXKRTSJ-UHFFFAOYSA-N |
| Molecular Formula | BH8NaO6 |
Potassium tellurite monohydrate, 97%
CAS: 123333-66-4 Molecular Formula: K2O3Te·H2O MDL Number: MFCD00149923 Synonym: potassium tellurite,potassium tellurate iv,dipotassium tellurite,dipotassium trioxotellurate,telluric acid, dipotassium salt,potassiium tellurite iv,telluric acid h2teo3 , dipotassium salt,dipotassium ion tellurite,acmc-1bm2e
| CAS | 123333-66-4 |
|---|---|
| MDL Number | MFCD00149923 |
| Synonym | potassium tellurite,potassium tellurate iv,dipotassium tellurite,dipotassium trioxotellurate,telluric acid, dipotassium salt,potassiium tellurite iv,telluric acid h2teo3 , dipotassium salt,dipotassium ion tellurite,acmc-1bm2e |
| Molecular Formula | K2O3Te·H2O |
Aluminum wire, 1.0mm (0.04in) dia, annealed, Puratronic™, 99.9995% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 IUPAC Name: aluminum SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| IUPAC Name | aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
| Packaging | Plastic bottle |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Ringer's Solution |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
Potassium phosphate, monobasic, 99%, for analysis
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 IUPAC Name: potassium;dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| IUPAC Name | potassium;dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |
Zirconium boride, 99.5% (metals basis excluding Hf), Thermo Scientific Chemicals
CAS: 12045-64-6 Molecular Formula: B2Zr Molecular Weight (g/mol): 112.844 MDL Number: MFCD00064648 InChI Key: VWZIXVXBCBBRGP-UHFFFAOYSA-N Synonym: Zirconium diboride PubChem CID: 9812765 IUPAC Name: boron;zirconium SMILES: [B].[B].[Zr]
| PubChem CID | 9812765 |
|---|---|
| CAS | 12045-64-6 |
| Molecular Weight (g/mol) | 112.844 |
| MDL Number | MFCD00064648 |
| SMILES | [B].[B].[Zr] |
| Synonym | Zirconium diboride |
| IUPAC Name | boron;zirconium |
| InChI Key | VWZIXVXBCBBRGP-UHFFFAOYSA-N |
| Molecular Formula | B2Zr |
Hafnium boride, 99.5% (metals basis excluding Zr), Zr <2%, Thermo Scientific Chemicals
CAS: 12007-23-7 Molecular Formula: B2Hf MDL Number: MFCD00016125
| CAS | 12007-23-7 |
|---|---|
| MDL Number | MFCD00016125 |
| Molecular Formula | B2Hf |
Titanium boride, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 12045-63-5 Molecular Formula: B2Ti Molecular Weight (g/mol): 69.487 MDL Number: MFCD00049595 InChI Key: QYEXBYZXHDUPRC-UHFFFAOYSA-N Synonym: titanium boride, PubChem CID: 131664302 IUPAC Name: boron;titanium SMILES: [B].[B].[Ti]
| PubChem CID | 131664302 |
|---|---|
| CAS | 12045-63-5 |
| Molecular Weight (g/mol) | 69.487 |
| MDL Number | MFCD00049595 |
| SMILES | [B].[B].[Ti] |
| Synonym | titanium boride, |
| IUPAC Name | boron;titanium |
| InChI Key | QYEXBYZXHDUPRC-UHFFFAOYSA-N |
| Molecular Formula | B2Ti |
Lithium perchlorate trihydrate, 99%, extra pure
CAS: 13453-78-6 Molecular Formula: ClLiO4·3H2O Molecular Weight (g/mol): 160.44 MDL Number: MFCD00149765 InChI Key: JAWYRNYHJJDXHX-UHFFFAOYSA-M Synonym: lithium perchlorate trihydrate,perchloric acid, lithium salt, trihydrate,unii-jyk745743v,acmc-1c1zx,lithium perchlorate hydrate,lithiumperchlorate trihydrate,ksc491a4p,lithium pechlorate trihydrate,lithiumperchloratetrihydrate,lithotab trihydrate perchlorate ion PubChem CID: 23708903 IUPAC Name: lithium;perchlorate;trihydrate SMILES: [Li+].O.O.O.[O-]Cl(=O)(=O)=O
| PubChem CID | 23708903 |
|---|---|
| CAS | 13453-78-6 |
| Molecular Weight (g/mol) | 160.44 |
| MDL Number | MFCD00149765 |
| SMILES | [Li+].O.O.O.[O-]Cl(=O)(=O)=O |
| Synonym | lithium perchlorate trihydrate,perchloric acid, lithium salt, trihydrate,unii-jyk745743v,acmc-1c1zx,lithium perchlorate hydrate,lithiumperchlorate trihydrate,ksc491a4p,lithium pechlorate trihydrate,lithiumperchloratetrihydrate,lithotab trihydrate perchlorate ion |
| IUPAC Name | lithium;perchlorate;trihydrate |
| InChI Key | JAWYRNYHJJDXHX-UHFFFAOYSA-M |
| Molecular Formula | ClLiO4·3H2O |